On Target ACE_HUMAN 0.4417178/CHEMBL3414811
For the given ligand D3263, we have found in our database that, being scored 0.4417178, the most similar ligand is CHEMBL3414811. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL3414811 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | OC(COc1cccc2[nH]c3ccccc3c12)CN4C(=O)c5ccccc5N=C4C(F)(F)F |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 04000002 00000008 a0100008 10010600 000c1060 02004120 06081800 00000008 06000102 c08208e0 0500000c 40018000 00809806 0ae00000 013200c1 020c600c 00200000 00008004 00e00000 00060000 c1000000 18008038 27800041 8c300010 00002000 c0000000 20000200 90840030 00004204 00460000 402c0200 402002c0 |