On Target 5HT1B_HUMAN 0.40268457/CHEMBL321190
For the given ligand D3263, we have found in our database that, being scored 0.40268457, the most similar ligand is CHEMBL321190. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL321190 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | CCCCCCCCC(=O)Oc1ccc2[nH]cc(CCN(C)C)c2c1 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 04010002 01000808 20100108 41010710 000c1000 02000000 060c2000 00000000 00400000 00090840 08200004 40009000 1480880e 00c00000 11010041 000c200c 00820000 02000000 00602400 00020001 40000000 18208a08 31800000 91400010 00042000 80000000 08120000 00000000 04000200 00060002 00060200 10000620 |