On Target TLR4_HUMAN 0.37777779/CHEMBL1223752
For the given ligand D3263, we have found in our database that, being scored 0.37777779, the most similar ligand is CHEMBL1223752. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL1223752 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | CC(C)CC(=O)Nc1ccc(OC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 04014002 01000008 20100008 00010700 20081000 02002000 02000000 00000008 00000000 000008c0 00280004 40009000 0480802a 00900000 11030041 00082008 00860000 00000000 0a402000 00020001 40100000 18000e00 31002000 00000010 00000000 00000000 00040000 10000080 00008200 00060001 00020000 10000200 |