On Target OPRD_HUMAN 0.48630136/CHEMBL427683
For the given ligand D3263, we have found in our database that, being scored 0.48630136, the most similar ligand is CHEMBL427683. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL427683 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | COc1ccc(C)c(OC(CCN2CCC(CC2)N3C(=O)Nc4ccccc34)C(C)C)c1 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 04000003 01000408 20100108 00010600 000c1040 02004080 42040000 20000000 04200100 800009e0 0d20800c 50018000 00809002 01c40000 013000c1 000c200c 00300000 22008004 00e00000 00020a01 c0000000 18000030 21800081 00700010 00000001 c0000000 00020000 10000000 00010300 00460010 40080000 000022c0 |