On Target CXCR4_HUMAN 0.38356164/CHEMBL853
For the given ligand D3263, we have found in our database that, being scored 0.38356164, the most similar ligand is CHEMBL853. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL853 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | NC1=NC(=O)N(C=C1)[C@H]2CC[C@@H](CO)O2 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 00000002 01400000 00000000 88090600 00180040 00004040 00009400 00000800 04000100 810000b0 0400000c 40019004 00009000 03c80110 00281080 001c800c 00200000 00000000 08400000 00201001 80080020 18000010 25800041 08600810 10000400 40000002 00000200 10000060 00000208 01460000 40280000 000000c0 |