On Target CNR2_HUMAN 0.5486111/CHEMBL498152
For the given ligand D3263, we have found in our database that, being scored 0.5486111, the most similar ligand is CHEMBL498152. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL498152 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | CN(C)CCN1C(=O)N(C(=O)N[C@H](C(=O)N)C(C)(C)C)c2ccccc12 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 01000002 01203400 00100180 40010f00 001c0040 00004000 00000000 c0002000 04200101 000008f0 0d20900c 4001b000 0400b000 01c00180 003008c0 000c0004 00830000 00008000 00e00088 00000001 c0000000 38010630 21800081 02200018 1c000001 40040001 00000000 00080010 08000000 00460013 60084000 00000a80 |