On Target OPRX_HUMAN 0.5703704/CHEMBL1080485
For the given ligand D3263, we have found in our database that, being scored 0.5703704, the most similar ligand is CHEMBL1080485. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL1080485 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | CNC(=O)CN1C(=O)N(C2CCN(CC2)[C@@H]3CC[C@@H](CC3)C(C)C)c4ccccc14 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 00000002 01000c00 00100000 40010700 001c0040 00006080 00000000 20000000 04200101 800009e0 0d20900c 5001a000 00009002 01c40000 003008c0 0c0c1004 00900000 40000000 02602000 00000201 c0000000 38000630 21800001 00300016 1c000000 40000000 00000000 10000000 08000000 00460011 400a0000 00002a80 |