On Target FYN_HUMAN 0.43030304/CHEMBL3335371
For the given ligand D3263, we have found in our database that, being scored 0.43030304, the most similar ligand is CHEMBL3335371. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL3335371 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | CC(=O)Nc1cc(Oc2ccc3c(c2)nc(Nc4cccc(c4)C(C)(C)C)n3C)ccn1 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 00004006 80000008 20084108 00010600 10041040 00004000 06080000 00000008 00400100 200808d0 0938800c 40018800 00009806 08500000 01000041 000c004c 00040080 1200400c 08602000 10a62000 c4500000 5c008630 21802801 00602010 00042000 80000000 04000080 00210080 00408208 00461803 40001400 002a0780 |