On Target CAH2_HUMAN 0.45341614/CHEMBL3827113
For the given ligand D3263, we have found in our database that, being scored 0.45341614, the most similar ligand is CHEMBL3827113. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL3827113 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | COc1cc2N=C(S)N(CCc3ccc(cc3)S(=O)(=O)N)C(=O)c2cc1OC |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 00000012 00801208 21000108 00b10600 000c1008 00004020 06080000 00000008 06100100 c00808e0 0900200c 60018000 0000d006 00e00081 812000c1 000c800c 00000000 02008008 00600000 00862811 c0000000 18040038 21810041 89700018 02002000 80000000 20000000 00040028 04004200 2046000a 40080020 002104e0 |