On Target CDK5_HUMAN 0.3472222/CHEMBL1994956
For the given ligand D3263, we have found in our database that, being scored 0.3472222, the most similar ligand is CHEMBL1994956. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL1994956 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | CC(=O)n1nc(N)c2ccc(Br)cc12 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 00004007 00008408 20000080 00000700 000c0000 00000000 02000000 00000000 00000000 100008c0 0000000d 4001c000 00009032 00c00000 000100c0 000c400c 00030000 00000000 00600000 00220000 c0000000 1c010618 31801801 02200000 00120000 00000002 00060000 00001002 00000008 000e0003 00000008 1a004060 |