On Target ESR1_HUMAN 0.41463414/CHEMBL1395826
For the given ligand D3263, we have found in our database that, being scored 0.41463414, the most similar ligand is CHEMBL1395826. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL1395826 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | OC1(CCN(CC1)C(=O)CCCCCN2C(=S)Nc3ccccc3C2=O)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 00058012 01001200 00100100 00010600 000c0000 00004060 02000000 20000800 06000900 c00c08e0 0930000c 50019800 060090ae 00e00000 000000c0 000c000c 20000000 03008100 00e02020 00010201 c0000100 18140738 218000c1 00700018 00002001 80000000 20040000 10040000 00004000 0047000b 40080000 00032688 |