On Target MIF_HUMAN 0.29353234/CHEMBL3943378
For the given ligand D3263, we have found in our database that, being scored 0.29353234, the most similar ligand is CHEMBL3943378. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL3943378 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | Oc1ccc(cc1)n2cc(nn2)c3ccc4cc(OCC5CCCCO5)ccc4n3 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 04000002 41010018 60004108 18810710 a00c1020 0200400c 02080000 00301840 00002100 10000860 80008004 40008840 00800886 00c00000 11230041 820cb00c 00820040 82003000 84642102 00463001 40020360 18188028 25801040 89404010 00202403 80200000 30040040 00802060 0500420c 10060400 50040200 17000000 |