On Target MK03_HUMAN 0.33557048/CHEMBL29197
For the given ligand D3263, we have found in our database that, being scored 0.33557048, the most similar ligand is CHEMBL29197. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL29197 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | COc1cc2ncnc(Nc3cccc(Br)c3)c2cc1OC |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 00004002 00008008 20000008 08080600 00041000 00004000 06088010 00000808 80002100 00000840 01300005 40009000 04004036 00400000 01000041 000c800c 00040000 10004008 0860000a 10270400 40000000 08040028 20804040 00000000 00002000 00000000 02070000 00000080 00008208 00460008 40000008 082000c0 |