On Target NMDZ1_HUMAN 0.1764706/CHEMBL86313
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.1764706, the most similar ligand is CHEMBL86313. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL86313 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | C[C@@H](NCc1cc(Br)cc2nc(O)c(O)nc12)P(=O)(O)O |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 10014012 22008e18 40000102 00010610 00040040 00c00004 0400c000 02601000 40000080 01000840 01200004 c0008000 80000832 00420000 60840548 0004800c 08022028 02000000 00200000 00000000 40020020 0d308800 21800400 00400000 00044400 c4000004 08068040 80016004 01000100 200e0000 00048008 8d008223 |