On Target PERM_HUMAN 0.21428572/CHEMBL4069712
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.21428572, the most similar ligand is CHEMBL4069712. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL4069712 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | Cc1nc(N=C(N)N)nc2cc(Br)ccc12 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00004002 00008800 00000100 00850e00 01040204 00004000 00002000 00020000 00000100 02000842 01000004 c0008800 00000010 00500008 04020040 000c000c 00000800 02000400 00600000 00200000 40000002 0c000028 20800a40 00600100 00000000 80008000 40860000 00000000 0000000c 004e0000 40000008 090000a0 |