On Target PDE5A_HUMAN 0.1981132/CHEMBL557266
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.1981132, the most similar ligand is CHEMBL557266. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL557266 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | COc1ccc(CN2C(=O)C=Cc3ccc(cc23)c4ccncc4)cc1 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00002002 00000a08 20004108 00010600 00041000 00002060 02040000 00001000 06100000 400008e0 04000004 60018000 80008802 00600000 01100041 0004000c 00020000 02804000 04200000 00020000 40000000 18028018 30800000 81700008 00000000 c0000000 00220040 00040050 04004200 00060008 00040000 00000020 |