On Target COMT_HUMAN 0.20430107/CHEMBL3335576
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.20430107, the most similar ligand is CHEMBL3335576. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL3335576 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | OC1=CN=C(NC1=O)c2cccc(c2)c3ccccc3 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00002002 00000008 40000100 10010600 00000029 00004004 00801800 00080000 06000100 10000860 00008004 40008000 00008000 00400001 00020000 000c000c 00020020 0200b000 04400000 00400000 00000008 08000000 30800040 00500000 00000802 80000200 20000000 00040041 00004004 00420400 40000800 40000080 |