On Target TRPV1_RAT 0.23148148/CHEMBL387433
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.23148148, the most similar ligand is CHEMBL387433. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL387433 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | Cc1cccnc1c2ccc(cc2)C(=O)Nc3ccc(Br)cc3 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00006002 00008801 00004100 50010610 08041020 00000000 00000000 02081000 00000100 10000840 00288004 4000c000 80008810 00300000 20020040 02040004 00060000 02002004 0c200000 10400000 40100000 08028600 30812000 00400004 00040000 80000000 08220040 800000c0 0040c104 00060401 80040808 08000200 |