On Target FABP5_HUMAN 0.15436241/CHEMBL3941588
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.15436241, the most similar ligand is CHEMBL3941588. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL3941588 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | OC(=O)c1c(nc2ccc(Cl)cc2c1c3ccccc3)N4CCCCC4 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 1801e002 01800801 40104100 00010610 20041004 0001e040 04000000 00100000 00c00100 200008d0 00200004 70019800 8700880e 00600000 20020040 000c000e 00060000 02004004 0c200000 00a00201 c0100000 1c068b68 30800800 8070001c 00042000 80080000 08040280 100010c0 0040c008 00060800 c0041000 01020220 |