On Target PAR1_HUMAN 0.21505377/CHEMBL2047297
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.21505377, the most similar ligand is CHEMBL2047297. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL2047297 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | CCCCNc1cccc(NC(=O)c2ccccc2Br)c1 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00004002 00008800 00100100 00010600 28000000 00002000 00000800 02001000 00000000 000008c0 00280004 4080c000 00008810 00100000 40020440 00000000 00040000 02000000 08000000 20000001 40100000 18028600 20012000 00400014 00080000 80100000 00020400 90000080 00808100 00060001 a0040008 08000200 |