On Target HYES_HUMAN 0.23595506/CHEMBL3765559
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.23595506, the most similar ligand is CHEMBL3765559. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL3765559 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | OC(=O)c1ccc(cc1)c2ccc(cc2)C(=O)NCc3ccccc3C(F)(F)F |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00002000 00800800 00100100 50050600 00000000 00004000 00000400 02001000 00000100 00000850 00200000 40008000 80008802 01200000 00000480 00080008 00022000 02000000 04002000 10000000 84020000 08028e20 10000000 0040000c 00000000 c0000000 00004000 90000040 00004100 00060001 c0160000 00000200 |