On Target AOFA_HUMAN 0.24705882/CHEMBL2426048
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.24705882, the most similar ligand is CHEMBL2426048. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL2426048 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | OC(CNCC#C)COc1ccc(cc1)c2ccccc2 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 04002000 00000008 20100108 00010600 00403080 02000000 02040000 00100800 00000000 00000840 00200000 40008000 00800012 00000000 01300001 00082008 10220000 02000000 04800000 00020200 00000000 18000000 17010080 08400010 00000001 80000000 00020000 00800040 00004200 00060000 00000020 00000240 |