On Target GLRA3_HUMAN 0.07/CHEMBL4074873
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.07, the most similar ligand is CHEMBL4074873. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL4074873 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | CN1C(=O)[C@@H]2CN(C[C@@H]2c3cnccc13)S(=O)(=O)c4ccc5occc5c4 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00020052 22a04600 01184100 01b00610 200c1200 00002050 1201a000 40200200 00604880 004909e0 00382034 60029000 4c008c03 00100981 80e20000 00040006 0004e004 0a000004 00600418 00007e03 e0100100 18248608 20804000 99480018 0a041800 0100000c 08028010 1800108c 04482400 21060a1b 00000080 20812670 |