On Target PPARG_HUMAN 0.22222222/CHEMBL182884
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.22222222, the most similar ligand is CHEMBL182884. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL182884 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | CO[C@@H](Cc1ccc(OCCCOc2ccc(cc2)c3ccccc3)cc1)C(=O)O |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 04002000 00000008 20000108 00010200 00001040 02000000 02040000 00000040 00000800 01080840 08100000 4000d000 04808012 00000000 01040001 00082008 08020000 82000000 05400008 00020001 00000100 18000a00 15000040 0a400010 00000800 80000000 00120000 00000040 00004200 00020002 00000000 00000400 |