On Target CASP1_HUMAN 0.1764706/CHEMBL410908
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.1764706, the most similar ligand is CHEMBL410908. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL410908 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | OC(=O)[C@H](NS(=O)(=O)c1ccccc1Oc2ccc(cc2)c3ccccc3)C=O |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 04002010 00800008 21000108 01b10600 00089000 00000000 02040200 00000000 00040100 00000840 00002000 6000b000 10008012 00000001 81200001 00080008 01022201 02000000 04402000 00026500 80441000 08000a01 13100000 58400058 02008000 80000004 00020000 0120004c 00004640 20060000 00000400 00011068 |