On Target PPAP_HUMAN 0.1744186/CHEMBL498632
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.1744186, the most similar ligand is CHEMBL498632. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL498632 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | OP(=O)(O)C(NCc1ccccc1)c2ccccc2 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00010010 00000600 00000100 00010600 00000000 00400000 04000000 02001000 000000c0 00000840 00200000 40008000 00000802 00020000 8008040c 00000000 00003028 02000000 00000000 00000200 00000000 0d308000 00000000 00400000 00000000 c6010006 00000000 80014000 00000100 30060000 00040000 00008203 |