On Target PDE4B_HUMAN 0.21008404/CHEMBL1957299
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.21008404, the most similar ligand is CHEMBL1957299. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL1957299 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | Brc1ccc2[nH]cc(c3nc4ccccc4cc3C#N)c2c1 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00006002 00018801 00004100 10010210 0c041020 04010008 00000001 00080000 00100100 10810840 00100004 60018010 00000830 00600000 20020040 820c000c 00420000 02003004 04a00000 00c00000 40000000 08028008 30800480 82400008 00040003 80080000 08120640 00000040 0040c004 000e0400 00040a08 08000220 |