On Target TNFA_HUMAN 0.15972222/CHEMBL1417851
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.15972222, the most similar ligand is CHEMBL1417851. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL1417851 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | COCCn1c(C)cc(C(=O)COC(=O)c2ccccc2Br)c1C |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 0000400a 00809800 00100100 50010618 00004070 0000c000 00002000 00000044 00400100 000a38d0 00000004 4081c000 00088010 00218000 400a1880 0a0c400c 18224000 82800004 04200400 00000000 84010020 18268a30 23804000 0450001c 00042400 c0002000 080a0200 10001014 00000204 40060842 c0000208 0a000020 |