On Target ACHA9_HUMAN 0.08791209/CHEMBL386114
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.08791209, the most similar ligand is CHEMBL386114. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL386114 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | C[C@H](NC(=O)[C@H](CS)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](CS)NC(=O)[C@H](CS)NC(=O)CN)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00070002 01007a00 00100100 45910e10 00141282 00000010 00012000 2000000c 00600880 020f08c2 08300014 4003b000 1e008812 00442809 80180040 000c000c 10000800 02000001 00e00418 00400301 40000100 38348e28 23800283 97500018 00043801 80000000 48010000 10000000 0c000002 0006002b 20044200 03812e20 |