On Target DRD2_HUMAN 0.29333332/CHEMBL92817
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.29333332, the most similar ligand is CHEMBL92817. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL92817 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | CCCN1CCC[C@H](C1)c2cccc(Br)c2 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00004000 11008000 00100102 00010600 00000000 00000000 00000000 20000000 40100880 000808c0 08300000 d0018000 00000012 00200000 00000000 00000000 00000000 02000000 00000000 00000201 00000100 18200000 00000000 81500010 00000000 80000000 00020000 10000000 05800000 00060002 00000008 08002600 |