On Target NEP_HUMAN 0.2747253/CHEMBL4082357
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.2747253, the most similar ligand is CHEMBL4082357. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL4082357 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | OC(=O)C(CC(=O)C(S)Cc1ccc(cc1)c2ccccc2)Cc3ccc(Br)cc3 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00056000 01008000 00000102 00110200 00080008 00000000 00000000 00000000 00a00900 01090840 08100000 40029800 04008018 00a40000 00000000 00080008 00020000 02000400 04402008 10000001 00000100 08000a00 11000140 02400010 00000800 80000000 00120000 00000040 00004002 00060002 00020008 09410400 |