On Target NOS1_HUMAN 0.26027396/CHEMBL545025
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.26027396, the most similar ligand is CHEMBL545025. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL545025 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | Br.Br.CC(=N)NCc1ccc(NC(=N)C)cc1 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00004002 00000810 00000100 80010600 00000000 00000000 00000000 02001000 00000000 00000853 00200004 40008000 00000802 00008000 00000440 00100000 00040000 02000000 08000000 00000000 40120000 08008000 20000000 00400000 00000000 c0000000 40000000 90000080 00008110 00060000 00040008 04000200 |