On Target NK1R_HUMAN 0.30851063/CHEMBL202720
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.30851063, the most similar ligand is CHEMBL202720. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL202720 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | CN(Cc1cc(cc(c1)C(F)(F)F)C(F)(F)F)C(=O)c2ccccc2c3ccccc3Br |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 08006000 028a8801 00100100 10010600 00000001 40008000 10000420 02001000 00400000 10000850 01200000 40008002 00008812 01200000 60000400 00000008 00022000 02000000 04000000 00400000 80020000 08028600 90000020 0042000c 00000000 c0000000 08024000 90000040 00004100 00060001 80140008 08000200 |