On Target AOFB_HUMAN 0.29850745/CHEMBL2204773
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.29850745, the most similar ligand is CHEMBL2204773. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL2204773 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | Brc1ccc(Sc2ccc(cc2)C#N)cc1 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00004000 00809200 00020100 00110200 00040020 00000000 00000000 00000000 00000000 00800841 00000000 60008000 00000010 00010000 00000800 00000000 04401000 02000000 00a00000 00000000 80000000 08000000 00800400 00400009 00000000 80000000 40020000 00000000 00000200 00060400 00000008 08010020 |