On Target PGH1_SHEEP 0.3/CHEMBL161052
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL161052. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL161052 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | CC(C)Cc1ccc(cc1Br)C(C)C(=O)O |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00004000 10008000 00000100 00010200 00000040 00000000 00000000 00000000 40000900 00080840 08100000 c0009a00 01008010 00000000 40040200 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000020 80000000 00020000 00000000 02000000 00060002 00002008 08000400 |