On Target P2RX3_HUMAN 0.1764706/CHEMBL3669707
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.1764706, the most similar ligand is CHEMBL3669707. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL3669707 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | Brc1ccc(cc1)C(=O)C2C(C3CCCCC3)N(C(=O)C2=O)c4ccc(cc4)c5ccon5 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00036002 01009a00 001a0102 22010601 20020000 00102090 00000000 20000000 04120900 000808c0 08390004 5001b000 0e00801a 00309040 81020060 00440004 00060200 02000401 0e002018 00000201 40902100 18060610 30802000 0058009c 00001800 80000080 00120020 180000c1 0000c006 0006000b 80025008 48c02600 |