On Target MDR1_HUMAN 0.31578946/CHEMBL342696
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.31578946, the most similar ligand is CHEMBL342696. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL342696 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | Clc1ccc(cc1Cl)c2cc(Cl)c(Cl)c(Cl)c2 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000000 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 00002000 00000000 08000100 10000000 00400000 00002000 80100000 00040000 00000040 00004000 00020000 00000000 01020000 |