On Target AGTR2_HUMAN 0.14393939/CHEMBL290286
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.14393939, the most similar ligand is CHEMBL290286. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL290286 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | OC(=O)[C@@H]1Cc2cc(ccc2CN1C(=O)C(c3ccccc3)c4ccccc4)c5ccccc5 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 0000a008 00805000 00100100 10010600 000010a1 00000000 01001000 03001004 00000980 00080840 08300000 4000b000 87008882 00200000 c0080480 00080008 10020200 02001020 04400008 10000201 80020100 18208e00 13004040 81400018 00000800 e0000081 00004000 c0000041 04004180 00860003 20046000 00002600 |