On Target P2Y12_HUMAN 0.17322835/CHEMBL599606
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.17322835, the most similar ligand is CHEMBL599606. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL599606 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | CCOC(=O)N1CCN(CC1)C(=O)[C@H](CCC(=O)O)NC(=O)c2cc(cc(c2)c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 0003a000 01403800 00100100 04010600 00180001 04010000 10000000 22001008 00800200 000308c0 00200000 4001b000 06808832 01002000 00000400 081a0008 00020000 02001000 04400800 00000201 00000000 38068e10 11000023 0250001c 00000000 c0000002 08000000 90200061 18004300 00060001 a0044000 00800a00 |