On Target SCN9A_HUMAN 0.25/CHEMBL3682634
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL3682634. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL3682634 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | FC(F)(F)c1ccc(c(Br)c1)c2cccc3cc(ccc23)S(=O)(=O)Nc4ncns4 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 10006034 82808000 01900100 00b10200 00000006 00000000 02020740 00800100 40002100 00000850 00002000 e0009840 04000010 01000001 c0200080 00280004 40022000 02000000 04400018 10206001 80000000 0a201188 b0100004 084a0008 00000200 88400000 00820100 9800004c 00004448 20060000 00100108 08810260 |