On Target PRGR_HUMAN 0.24786325/CHEMBL25015
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.24786325, the most similar ligand is CHEMBL25015. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL25015 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | CC1(C)OC(=Nc2ccc(cc12)c3cccc(Br)c3)S |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 02006002 00008800 00500100 00110200 04000001 01004008 00000000 00400000 50000540 00080840 88200804 c8009001 00009010 48110000 108200c0 82280008 00020800 02001000 06080200 40008000 40000000 08030020 30000008 00400111 80080800 88002080 40020000 20000041 05014200 00060002 4200000c 28010600 |