On Target PGH2_HUMAN 0.29032257/CHEMBL317434
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.29032257, the most similar ligand is CHEMBL317434. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL317434 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | CC(C(=O)O)c1ccc(cc1)c2ccccc2 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00002000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000100 00080840 08000000 40009800 01008000 00000000 40040000 00080008 08020000 02000000 04000000 10000000 00000000 08000a00 11000000 00400010 00000000 80000000 00000000 00000040 00004000 00020002 00002000 00000400 |