On Target ACE_HUMAN 0.19626169/CHEMBL513671
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.19626169, the most similar ligand is CHEMBL513671. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL513671 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | C[C@H](CS)C(=O)N[C@@H](CSCc1ccc(Br)cc1)C(=O)O |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00004002 4000c000 20122528 08110600 00000080 00000000 00000000 00000000 00400000 02024840 00200000 4000b000 02019016 40040100 80080000 00080008 14000008 02100100 00000000 00401300 40000000 18000e00 03000600 04400018 00040200 80000000 00124000 00000000 00001000 00060021 20004008 0b010200 |