On Target 5HT1B_HUMAN 0.2125/CHEMBL2260929
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.2125, the most similar ligand is CHEMBL2260929. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL2260929 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | CNC(C)COc1c(Br)cccc1Br.OC(=O)C(=O)O |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 04006000 00008008 20000008 01010602 00001080 02000000 02000000 08000000 04000000 00000840 10200000 4000c000 00808012 00000001 01001001 00082008 00000000 00000000 00000000 00024000 00000000 08040a00 17000000 30000010 00000000 00000000 00020000 00000000 00000200 00060000 00000008 08000200 |