On Target OPRD_HUMAN 0.19736843/CHEMBL4094512
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.19736843, the most similar ligand is CHEMBL4094512. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL4094512 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | Cl.Oc1ccc(CCN(CCc2cccc(O)c2)CC3CCC3)cc1 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00000000 43000008 20100100 00010600 00000000 80000000 02000000 20000000 00000080 000808c0 08200000 40018000 00000002 00000010 00000000 00000008 00000000 02000000 00000000 00020201 00000000 18200000 00000000 81500010 00000000 80000000 00120000 10000000 04000000 00060002 00000000 00022600 |