On Target CNR2_HUMAN 0.2777778/CHEMBL16901
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.2777778, the most similar ligand is CHEMBL16901. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL16901 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | Oc1ccc(cc1CC=C)c2cc(CC=C)ccc2O |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00002000 00000008 20000100 00010200 00000001 00800000 02000001 00000600 00040000 00180840 08000000 40008000 00400032 00000000 00000000 00082008 00020000 02101000 04000000 00020000 00000000 08000000 10000000 00404010 00000000 80000080 10120000 00000041 00004000 00020002 04000200 00000400 |