On Target NTRK1_HUMAN 0.23333333/CHEMBL1971519
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.23333333, the most similar ligand is CHEMBL1971519. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL1971519 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | Nc1n[nH]c2cccc(c3ccc(F)cc3)c12 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00002003 00000008 20100100 02010200 00840004 00000010 02000000 00000000 00000000 10000840 00000004 60008000 00000012 00401000 00000040 0004400c 00020000 02000000 04600000 00320000 40000000 0c000008 30800800 00600008 00160000 80080000 00060240 00000041 00004008 00068000 00000000 00004260 |