On Target MTOR_HUMAN 0.1923077/CHEMBL3623601
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.1923077, the most similar ligand is CHEMBL3623601. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL3623601 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | O=C(C1CC1)n2ccc3c4C(=O)C=C(Nc4ccc23)c5ccccc5 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00002002 00000000 00004180 10010700 000c0020 00000060 00000000 00080000 02000000 d00008c0 00000004 40019000 04008800 01e00000 00020040 02040204 00070000 02006000 04200000 00400001 40000000 18008618 30800000 80500010 02000000 80000000 00000060 00040040 00004004 00060401 00040a00 40000400 |