On Target OPRX_HUMAN 0.21505377/CHEMBL232067
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.21505377, the most similar ligand is CHEMBL232067. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL232067 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | OC1(CCN(CC1)C(c2ccccc2)c3ccccc3)c4ccc(Br)cc4 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00004000 01008200 00100100 00010600 00000000 00004000 00000000 23001000 00000900 000808c0 08300000 50018000 00000812 00000000 00000400 000c0008 00000000 02001400 00800000 00000201 00000100 18008020 01000080 00500010 00000001 e0000000 00120000 d0000000 00000180 0006000a 60040008 08000600 |