On Target CAH2_HUMAN 0.36764705/CHEMBL3764147
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.36764705, the most similar ligand is CHEMBL3764147. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL3764147 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | NS(=O)(=O)c1ccc(cc1)c2ccc(cc2)c3ccc(Br)cc3 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00006010 00809000 01000100 00b10200 04000008 00000000 00000000 00000004 00000100 00000840 00002000 60008000 00000010 00000001 80200000 00000000 00020000 02000000 04000000 10002000 80000000 08000000 10000000 08400008 00000000 80000000 00120000 00000068 00004000 20060000 00000008 08010020 |